* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AZABICYCLO[4.1.0]HEPTANE |
| CAS: | 286-09-9 |
| English Synonyms: | 3-AZABICYCLO[4.1.0]HEPTANE |
| MDL Number.: | MFCD14581355 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C1CNCC2C1C2 |
| InChi: | InChI=1S/C6H11N/c1-2-7-4-6-3-5(1)6/h5-7H,1-4H2 |
| InChiKey: | InChIKey=MZFQJBMXUXJUHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.