* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 8-(6-CHLOROPYRIMIDIN-4-YL)-1,4-DIOXA-8-AZASPIRO[4.5]DECANE |
CAS: | 286469-80-5 |
English Synonyms: | 8-(6-CHLOROPYRIMIDIN-4-YL)-1,4-DIOXA-8-AZASPIRO[4.5]DECANE |
MDL Number.: | MFCD16659582 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1c(ncnc1Cl)N2CCC3(CC2)OCCO3 |
InChi: | InChI=1S/C11H14ClN3O2/c12-9-7-10(14-8-13-9)15-3-1-11(2-4-15)16-5-6-17-11/h7-8H,1-6H2 |
InChiKey: | InChIKey=OSWLFGDFMYRRDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.