* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LAURIC ACID-1,2,3,4-13C4 |
CAS: | 287111-14-2 |
English Synonyms: | DODECANOIC ACID-1,2,3,4-13C4 ; LAURIC ACID-1,2,3,4-13C4 |
MDL Number.: | MFCD01075552 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCCCC[13CH2][13CH2][13CH2][13C](=O)O |
InChi: | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i9+1,10+1,11+1,12+1 |
InChiKey: | InChIKey=POULHZVOKOAJMA-BMHINFNASA-N |
Property |
|
Melting Point: | 44-46 DEG C(LIT) |
Boiling Point: | 225 DEG C/100 MMHG(LIT) |
Comments: | MASS SHIFT: M+4 WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 204.27 BY ATOM % CALCULATION |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.