* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AMINOPHENAZINE |
| CAS: | 2876-23-5 |
| English Synonyms: | PHENAZIN-2-AMINE ; 2-AMINOPHENAZINE |
| MDL Number.: | MFCD00168265 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)nc3ccc(cc3n2)N |
| InChi: | InChI=1S/C12H9N3/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H,13H2 |
| InChiKey: | InChIKey=RHQTYDDJBYBCQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.