Molecular Structure:
CAS No.:
2879-42-7
Product Name.:
CCD No.:CCD00347867
Formula:C5 H Cl F3 N
MolWeight:167.517
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(27)
- Buyers(0)
- Spectrum(0)
- MSDS(1)
- Price(10)
|
|
| Product Name： | 3-CHLORO-2,5,6-TRIFLUOROPYRIDINE |
| CAS： | 2879-42-7 |
| English Synonyms： | 3-CHLORO-2,5,6-TRIFLUOROPYRIDINE |
| MDL Number.： | MFCD03001160 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | c1c(c(nc(c1Cl)F)F)F |
| InChi： | InChI=1S/C5HClF3N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| InChiKey： | InChIKey=OROKHXKJSDPRET-UHFFFAOYSA-N |
|
|
| Boiling Point： | 132-134 DEG C |
| Physical Property： | FLASHPOINT: >100 DEG C(212 DEG F) REFRACTIVE INDEX: 1.4560 |
| Comments： | BRN: 1424722 HARMFUL/IRRITANT HAZARD: R 20/21/22-34 HAZARD: S 26-36/37/39-45 TSCA: N UN NUMBER: UN1760 UNSPSC: 12352005 |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
