* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzoic acid, 2-(2-pyridinyl)-, ethyl ester |
CAS: | 28901-52-2 |
English Synonyms: | BENZOIC ACID, 2-(2-PYRIDINYL)-, ETHYL ESTER |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1=C(C=CC=C1)C1=C(C(=O)OCC)C=CC=C1 |
InChi: | InChI=1S/C14H13NO2/c1-2-17-14(16)12-8-4-3-7-11(12)13-9-5-6-10-15-13/h3-10H,2H2,1H3 |
InChiKey: | InChIKey=SYTSMWKUYQQFPH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.