* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-METHYL-2H-1,2-BENZOTHIAZIN-3(4H)-ONE 1,1-DIOXIDE |
CAS: | 29209-01-6 |
English Synonyms: | 2-METHYL-2H-1,2-BENZOTHIAZIN-3(4H)-ONE 1,1-DIOXIDE ; 2H-1,2-BENZOTHIAZIN-3(4H)-ONE, 2-METHYL-, 1,1-DIOXIDE |
MDL Number.: | MFCD01663241 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CN1C(=O)Cc2ccccc2S1(=O)=O |
InChi: | InChI=1S/C9H9NO3S/c1-10-9(11)6-7-4-2-3-5-8(7)14(10,12)13/h2-5H,6H2,1H3 |
InChiKey: | InChIKey=GGPCERYTJXDGOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.