* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-FMOC RHODAMINE 110 |
CAS: | 293313-27-6 |
English Synonyms: | N-FMOC RHODAMINE 110 |
MDL Number.: | MFCD03093317 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)Nc4ccc5c(c4)c(c6cc(ccc6[o+]5)N)c7ccccc7C(=O)O.[Cl-] |
InChi: | InChI=1S/C35H24N2O5.ClH/c36-20-13-15-31-28(17-20)33(26-11-5-6-12-27(26)34(38)39)29-18-21(14-16-32(29)42-31)37-35(40)41-19-30-24-9-3-1-7-22(24)23-8-2-4-10-25(23)30;/h1-18,30H,19,36H2,(H-,37,38,39,40);1H |
InChiKey: | InChIKey=RENPABVUARNFJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.