Molecular Structure:
CAS No.:
2944-66-3
;13492-45-0
Product Name.:
CCD No.:CCD00036655
Formula:C6 Fe2 O12
MolWeight:375.744
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(6)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | FERRIC OXALATE |
| CAS： | 2944-66-3 ;13492-45-0 |
| English Synonyms： | FERRIC OXALATE ; IRON (III) OXALATE |
| MDL Number.： | MFCD00054430 |
| H bond acceptor： | 12 |
| H bond donor： | 0 |
| Smile： | C1(=O)C(=O)O[Fe](O1)OC(=O)C(=O)O[Fe]2OC(=O)C(=O)O2 |
| InChi： | InChI=1S/3C2H2O4.2Fe/c3*3-1(4)2(5)6;;/h3*(H,3,4)(H,5,6);;/q;;;2*+3/p-6 |
| InChiKey： | InChIKey=VEPSWGHMGZQCIN-UHFFFAOYSA-H |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
