* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(BENZYLOXY)BENZAMIDE |
CAS: | 29579-11-1 |
English Synonyms: | 2-(BENZYLOXY)BENZAMIDE |
MDL Number.: | MFCD00025471 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)COc2ccccc2C(=O)N |
InChi: | InChI=1S/C14H13NO2/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9H,10H2,(H2,15,16) |
InChiKey: | InChIKey=HHKNJUHXNDIVFN-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.