* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OXYPROTHEPIN |
CAS: | 29604-16-8 |
English Synonyms: | OXYPROTHEPIN |
MDL Number.: | MFCD00869823 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CSc1ccc2c(c1)C(Cc3ccccc3S2)N4CCN(CC4)CCCO |
InChi: | InChI=1S/C22H28N2OS2/c1-26-18-7-8-22-19(16-18)20(15-17-5-2-3-6-21(17)27-22)24-12-10-23(11-13-24)9-4-14-25/h2-3,5-8,16,20,25H,4,9-15H2,1H3 |
InChiKey: | InChIKey=HQOCWPHRUQRXEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.