* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1-BUTYLPENTYL)-PYRIDINE |
CAS: | 2961-49-1 |
English Synonyms: | 2-(1-BUTYLPENTYL)-PYRIDINE |
MDL Number.: | MFCD00085619 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCCCC(CCCC)c1ccccn1 |
InChi: | InChI=1S/C14H23N/c1-3-5-9-13(10-6-4-2)14-11-7-8-12-15-14/h7-8,11-13H,3-6,9-10H2,1-2H3 |
InChiKey: | InChIKey=YGCMUHWPXXEZCR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.