* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RACEMORPHAN |
CAS: | 297-90-5 |
English Synonyms: | RACEMORPHAN |
MDL Number.: | MFCD00866832 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4c3cc(cc4)O |
InChi: | InChI=1S/C17H23NO/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17/h5-6,11,14,16,19H,2-4,7-10H2,1H3/t14-,16+,17+/m1/s1 |
InChiKey: | InChIKey=JAQUASYNZVUNQP-PVAVHDDUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.