* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BOC-PRO-PRO-PRO-PRO-OH |
| CAS: | 29804-52-2 |
| English Synonyms: | BOC-PRO-PRO-PRO-PRO-OH |
| MDL Number.: | MFCD00133644 |
| H bond acceptor: | 11 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)N4CCC[C@H]4C(=O)O |
| InChi: | InChI=1S/C25H38N4O7/c1-25(2,3)36-24(35)29-15-6-10-18(29)22(32)27-13-4-8-16(27)20(30)26-12-5-9-17(26)21(31)28-14-7-11-19(28)23(33)34/h16-19H,4-15H2,1-3H3,(H,33,34)/t16-,17-,18-,19-/m0/s1 |
| InChiKey: | InChIKey=RSIYRONDCOJJQA-VJANTYMQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.