* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MOFOXIME |
CAS: | 29936-79-6 |
English Synonyms: | MOFOXIME |
MDL Number.: | MFCD00868622 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C/C(=N\O)/c1ccc(cc1)OCC(=O)N2CCOCC2 |
InChi: | InChI=1S/C14H18N2O4/c1-11(15-18)12-2-4-13(5-3-12)20-10-14(17)16-6-8-19-9-7-16/h2-5,18H,6-10H2,1H3/b15-11+ |
InChiKey: | InChIKey=JIFQTCBNOSCGJR-RVDMUPIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.