* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,1'-THIOBIS-1H-IMIDAZOLE, S-OXIDE |
| CAS: | 3005-50-3 |
| English Synonyms: | 1,1'-THIONYLIMIDAZOLE ; 1,1'-THIOBIS-1H-IMIDAZOLE, S-OXIDE |
| MDL Number.: | MFCD16876680 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1cn(cn1)S(=O)n2ccnc2 |
| InChi: | InChI=1S/C6H6N4OS/c11-12(9-3-1-7-5-9)10-4-2-8-6-10/h1-6H |
| InChiKey: | InChIKey=CNJBTSUNQWPABV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.