Molecular Structure:
CAS No.:
300816-15-3
Product Name.:
CCD No.:CCD00711137
Formula:C25 H27 N3 O3
MolWeight:417.506
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(13)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(5)
|
|
| Product Name： | RS 504393 |
| CAS： | 300816-15-3 |
| English Synonyms： | 6-METHYL-1'-[2-(5-METHYL-2-PHENYL-4-OXAZOLYL)ETHYL]-SPIRO[4H-3,1-BENZOXAZINE-4,4'-PIPERIDIN]-2(1H)-ONE ; RS 504393 |
| MDL Number.： | MFCD09038564 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | Cc1ccc2c(c1)C3(CCN(CC3)CCc4c(oc(n4)c5ccccc5)C)OC(=O)N2 |
| InChi： | InChI=1S/C25H27N3O3/c1-17-8-9-22-20(16-17)25(31-24(29)27-22)11-14-28(15-12-25)13-10-21-18(2)30-23(26-21)19-6-4-3-5-7-19/h3-9,16H,10-15H2,1-2H3,(H,27,29) |
| InChiKey： | InChIKey=ODNICNWASXKNNQ-UHFFFAOYSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
