* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | S 24795 |
| CAS: | 304679-75-2 |
| English Synonyms: | 2-[2-(4-BROMOPHENYL)-2-OXOETHYL]-1-METHYLPYRIDINIUM IODIDE ; S 24795 |
| MDL Number.: | MFCD18086873 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C[n+]1ccccc1CC(=O)c2ccc(cc2)Br.[I-] |
| InChi: | InChI=1S/C14H13BrNO.HI/c1-16-9-3-2-4-13(16)10-14(17)11-5-7-12(15)8-6-11;/h2-9H,10H2,1H3;1H/q+1;/p-1 |
| InChiKey: | InChIKey=LERUHBBUGAOYOD-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.