* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ADAMANTANE-D16 |
CAS: | 30470-60-1 |
English Synonyms: | ADAMANTANE-D16 |
MDL Number.: | MFCD00143556 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [2H]C1([C@]2(C([C@]3(C([C@@]1(C([C@@](C2([2H])[2H])(C3([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H] |
InChiKey: | InChIKey=null |
Property |
|
Melting Point: | 209-212 DEG C (SUBL)(LIT) |
Comments: | MASS SHIFT: M+16 WGK: 3 |
Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 152.013 BY ATOM % CALCULATION |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.