* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-D-ALA-D-PHE-OH |
CAS: | 3061-94-7 |
English Synonyms: | H-D-ALA-D-PHE-OH |
MDL Number.: | MFCD00066029 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C[C@H](C(=O)N[C@H](Cc1ccccc1)C(=O)O)N |
InChi: | InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m1/s1 |
InChiKey: | InChIKey=OMNVYXHOSHNURL-PSASIEDQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.