* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLIDAZAMIDE |
| CAS: | 3074-35-9 |
| English Synonyms: | GLIDAZAMIDE |
| MDL Number.: | MFCD00865491 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1S(=O)(=O)NC(=O)NN3CCCCCC3)CCC2 |
| InChi: | InChI=1S/C16H23N3O3S/c20-16(17-19-10-3-1-2-4-11-19)18-23(21,22)15-9-8-13-6-5-7-14(13)12-15/h8-9,12H,1-7,10-11H2,(H2,17,18,20) |
| InChiKey: | InChIKey=BAMWZWFFSCYCGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.