* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMADINONE |
CAS: | 30781-27-2 |
English Synonyms: | AMADINONE |
MDL Number.: | MFCD09837894 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=C(C4=CC(=O)CC[C@H]34)Cl)C)O |
InChi: | InChI=1S/C20H25ClO3/c1-11(22)20(24)8-6-17-15-10-18(21)16-9-12(23)3-4-13(16)14(15)5-7-19(17,20)2/h9-10,13-15,17,24H,3-8H2,1-2H3/t13-,14-,15-,17+,19+,20+/m1/s1 |
InChiKey: | InChIKey=ANJGIFXUFSBZPX-WLCXVKOPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.