* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4-DICHLORO-6-(4-CHLOROPHENOXY)-1,3,5-TRIAZINE |
CAS: | 30886-26-1 |
English Synonyms: | 2,4-DICHLORO-6-(4-CHLOROPHENOXY)-1,3,5-TRIAZINE |
MDL Number.: | MFCD00117217 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc(ccc1Oc2nc(nc(n2)Cl)Cl)Cl |
InChi: | InChI=1S/C9H4Cl3N3O/c10-5-1-3-6(4-2-5)16-9-14-7(11)13-8(12)15-9/h1-4H |
InChiKey: | InChIKey=PCFINNFBQJCQRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.