* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRIDO[3,2-E]-AS-TRIAZINE, 1,2-DIHYDRO |
CAS: | 30955-42-1 |
English Synonyms: | PYRIDO[3,2-E]-AS-TRIAZINE, 1,2-DIHYDRO |
MDL Number.: | MFCD13175826 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(nc1)NNC=N2 |
InChi: | InChI=1S/C6H6N4/c1-2-5-6(7-3-1)10-9-4-8-5/h1-4H,(H,7,10)(H,8,9) |
InChiKey: | InChIKey=YZEFUHIDWUTUJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.