Molecular Structure:
CAS No.:
30955-42-1
Product Name.:
CCD No.:CCD01991332
Formula:C6 H6 N4
MolWeight:134.141
![PYRIDO[3,2-E]-AS-TRIAZINE, 1,2-DIHYDRO Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | PYRIDO[3,2-E]-AS-TRIAZINE, 1,2-DIHYDRO |
| CAS： | 30955-42-1 |
| English Synonyms： | PYRIDO[3,2-E]-AS-TRIAZINE, 1,2-DIHYDRO |
| MDL Number.： | MFCD13175826 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1cc2c(nc1)NNC=N2 |
| InChi： | InChI=1S/C6H6N4/c1-2-5-6(7-3-1)10-9-4-8-5/h1-4H,(H,7,10)(H,8,9) |
| InChiKey： | InChIKey=YZEFUHIDWUTUJO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
