* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-(4-CL-BENZYL)-8-((2-HO-ET)AMINO)-1,3-DIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
CAS: | 309937-60-8 |
English Synonyms: | 7-(4-CL-BENZYL)-8-((2-HO-ET)AMINO)-1,3-DIMETHYL-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
MDL Number.: | MFCD00836296 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | Cn1c2c(c(=O)n(c1=O)C)n(c(n2)NCCO)Cc3ccc(cc3)Cl |
InChi: | InChI=1S/C16H18ClN5O3/c1-20-13-12(14(24)21(2)16(20)25)22(15(19-13)18-7-8-23)9-10-3-5-11(17)6-4-10/h3-6,23H,7-9H2,1-2H3,(H,18,19) |
InChiKey: | InChIKey=HYMUCNXRVZQVTH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.