* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-NITRO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-YLAMINE |
CAS: | 31040-15-0 |
English Synonyms: | 6-NITRO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-YLAMINE ; 6-NITRO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE |
MDL Number.: | MFCD17014844 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1cc2nc(nn2cc1[N+](=O)[O-])N |
InChi: | InChI=1S/C6H5N5O2/c7-6-8-5-2-1-4(11(12)13)3-10(5)9-6/h1-3H,(H2,7,9) |
InChiKey: | InChIKey=DPFDCZNFMJEQCU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.