* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CYCLOHEPTEN-1-ONE, 5-(1-METHYLETHYL)-, (5R)- |
| CAS: | 310905-92-1 |
| English Synonyms: | 2-CYCLOHEPTEN-1-ONE, 5-(1-METHYLETHYL)-, (5R)- |
| MDL Number.: | MFCD18835988 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)[C@@H]1CCC(=O)C=CC1 |
| InChi: | InChI=1S/C10H16O/c1-8(2)9-4-3-5-10(11)7-6-9/h3,5,8-9H,4,6-7H2,1-2H3/t9-/m0/s1 |
| InChiKey: | InChIKey=AJIAOAOLKVNRQR-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.