* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4,6-TRIPHENYLPHENOL |
CAS: | 3140-01-0 |
English Synonyms: | 2,4,6-TRIPHENYLPHENOL |
MDL Number.: | MFCD00012297 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2cc(c(c(c2)c3ccccc3)O)c4ccccc4 |
InChi: | InChI=1S/C24H18O/c25-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20/h1-17,25H |
InChiKey: | InChIKey=OKFLKUZAJUNRDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.