* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BORONAL |
| CAS: | 3155-71-3 |
| English Synonyms: | BORONAL ; (E)-2-METHYL-4-(2,6,6-TRIMETHYLCYCLOHEX-1-EN-1-YL)BUT-2-ENAL |
| MDL Number.: | MFCD00568529 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC1=C(C(CCC1)(C)C)C/C=C(\C)/C=O |
| InChi: | InChI=1S/C14H22O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h7,10H,5-6,8-9H2,1-4H3/b11-7+ |
| InChiKey: | InChIKey=FJCQUJKUMKZEMH-YRNVUSSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.