* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ICA-105574 |
CAS: | 316146-57-3 |
English Synonyms: | 3-NITRO-N-(4-PHENOXYPHENYL)-BENZAMIDE ; ICA-105574 |
MDL Number.: | MFCD01596399 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)Oc2ccc(cc2)NC(=O)c3cccc(c3)[N+](=O)[O-] |
InChi: | InChI=1S/C19H14N2O4/c22-19(14-5-4-6-16(13-14)21(23)24)20-15-9-11-18(12-10-15)25-17-7-2-1-3-8-17/h1-13H,(H,20,22) |
InChiKey: | InChIKey=GDWKBKTVROCPNZ-UHFFFAOYSA-N |
Property |
|
Safety information |
|
Symbol: | GHS07 GHS09 |
Signal word: | Warning |
Hazard statements: | H317-H319-H400 |
Precautionary statements: | P273-P280-P305 + P351 + P338 |
hazard symbol: | Xi,N |
Risk Code: | R:36-43-50/53 |
Safe Code: | S:26-36/37-60-61 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.