* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Hexanoic acid, 6-[2-(1-methylethoxy)phenoxy]- |
CAS: | 316148-30-8 |
English Synonyms: | HEXANOIC ACID, 6-[2-(1-METHYLETHOXY)PHENOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)OC1=C(OCCCCCC(=O)O)C=CC=C1 |
InChi: | InChI=1S/C15H22O4/c1-12(2)19-14-9-6-5-8-13(14)18-11-7-3-4-10-15(16)17/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,16,17) |
InChiKey: | InChIKey=BJNBTIJGMWYBEN-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.