* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-Bromo-1,2,3-benzothiadiazole |
CAS: | 31860-03-4 |
English Synonyms: | 7-BROMO-1,2,3-BENZOTHIADIAZOLE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=CC=2N=NSC21 |
InChi: | InChI=1S/C6H3BrN2S/c7-4-2-1-3-5-6(4)10-9-8-5/h1-3H |
InChiKey: | InChIKey=XACDEEWYFGMTMO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.