Molecular Structure:
CAS No.:
32022-69-8
Product Name.:
CCD No.:CCD00089700
Formula:C10 H9 N O2
MolWeight:177.175
![INDOLE-3-ACETIC ACID, [2-14C] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | INDOLE-3-ACETIC ACID, [2-14C] |
| CAS： | 32022-69-8 |
| English Synonyms： | INDOLE-3-ACETIC ACID, [2-14C] |
| MDL Number.： | MFCD00189815 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | c1ccc2c(c1)c(c[nH]2)[14CH2]C(=O)O |
| InChi： | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i5+2 |
| InChiKey： | InChIKey=SEOVTRFCIGRIMH-RHRFEJLCSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
