* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLE-3-ACETIC ACID, [2-14C] |
CAS: | 32022-69-8 |
English Synonyms: | INDOLE-3-ACETIC ACID, [2-14C] |
MDL Number.: | MFCD00189815 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c(c[nH]2)[14CH2]C(=O)O |
InChi: | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i5+2 |
InChiKey: | InChIKey=SEOVTRFCIGRIMH-RHRFEJLCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.