* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BENZENE-1,2,4,5-TETRAAMINE |
CAS: | 3204-61-3 |
English Synonyms: | BENZENE-1,2,4,5-TETRAMINE ; BENZENE-1,2,4,5-TETRAAMINE |
MDL Number.: | MFCD00085286 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | c1c(c(cc(c1N)N)N)N |
InChi: | InChI=1S/C6H10N4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H,7-10H2 |
InChiKey: | InChIKey=ANUAIBBBDSEVKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.