* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3S)-3-METHYL-1(3H)-ISOBENZOFURANONE |
CAS: | 3205-17-2 |
English Synonyms: | (3S)-3-METHYL-1(3H)-ISOBENZOFURANONE |
MDL Number.: | MFCD15146040 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@H]1c2ccccc2C(=O)O1 |
InChi: | InChI=1S/C9H8O2/c1-6-7-4-2-3-5-8(7)9(10)11-6/h2-6H,1H3/t6-/m0/s1 |
InChiKey: | InChIKey=XJVDIMLQFRPIMP-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.