* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (E)-3-[1,1'-BIPHENYL]-2-YL-2-PROPENOIC ACID |
CAS: | 52148-90-0 ;32059-83-9 |
English Synonyms: | (E)-3-[1,1'-BIPHENYL]-2-YL-2-PROPENOIC ACID ; 2-PROPENOIC ACID, 3-[1,1'-BIPHENYL]-2-YL- ; 3-[1,1'-BIPHENYL]-2-YL-2-PROPENOIC ACID ; 2-PROPENOIC ACID, 3-[1,1'-BIPHENYL]-2-YL-, (E)- |
MDL Number.: | MFCD00156959 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2ccccc2/C=C/C(=O)O |
InChi: | InChI=1S/C15H12O2/c16-15(17)11-10-13-8-4-5-9-14(13)12-6-2-1-3-7-12/h1-11H,(H,16,17)/b11-10+ |
InChiKey: | InChIKey=SEFDLRRKWPJXIR-ZHACJKMWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.