* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HALOXON |
CAS: | 321-55-1 |
English Synonyms: | HALOXON |
MDL Number.: | MFCD00010716 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cc1c2ccc(cc2oc(=O)c1Cl)OP(=O)(OCCCl)OCCCl |
InChi: | InChI=1S/C14H14Cl3O6P/c1-9-11-3-2-10(8-12(11)22-14(18)13(9)17)23-24(19,20-6-4-15)21-7-5-16/h2-3,8H,4-7H2,1H3 |
InChiKey: | InChIKey=KULDXINYXFTXMO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.