* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5,6-DIFLUORO-2-NAPHTHOL |
| CAS: | 321319-15-7 |
| English Synonyms: | 5,6-DIFLUORO-2-NAPHTHOL ; 5,6-DIFLUORONAPHTHALEN-2-OL |
| MDL Number.: | MFCD11040443 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc(c(c2c1cc(cc2)O)F)F |
| InChi: | InChI=1S/C10H6F2O/c11-9-4-1-6-5-7(13)2-3-8(6)10(9)12/h1-5,13H |
| InChiKey: | InChIKey=REURAJIXHRFHNH-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.