* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Butanamine, 4-(2-methoxyphenoxy)- |
CAS: | 3245-89-4 |
English Synonyms: | 1-BUTANAMINE, 4-(2-METHOXYPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC1=C(OCCCCN)C=CC=C1 |
InChi: | InChI=1S/C11H17NO2/c1-13-10-6-2-3-7-11(10)14-9-5-4-8-12/h2-3,6-7H,4-5,8-9,12H2,1H3 |
InChiKey: | InChIKey=XPDOVPGEUSXAGF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.