* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,6-DINITROPYROGALLOL |
CAS: | 3264-71-9 |
English Synonyms: | 4,6-DINITROPYROGALLOL |
MDL Number.: | MFCD00082563 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | c1c(c(c(c(c1[N+](=O)[O-])O)O)O)[N+](=O)[O-] |
InChi: | InChI=1S/C6H4N2O7/c9-4-2(7(12)13)1-3(8(14)15)5(10)6(4)11/h1,9-11H |
InChiKey: | InChIKey=JJPIRJNQXIJGPL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.