* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 15-METHYL-2,3,5,6,8,9,11,12-OCTAHYDRO-1,4,7,10,13-BENZOPENTAOXACYCLOPENTADECINE |
CAS: | 32702-27-5 |
English Synonyms: | 15-METHYL-2,3,5,6,8,9,11,12-OCTAHYDRO-1,4,7,10,13-BENZOPENTAOXACYCLOPENTADECINE ; 4-METHYLBENZO-15-CROWN-5 |
MDL Number.: | MFCD00068663 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(c1)OCCOCCOCCOCCO2 |
InChi: | InChI=1S/C15H22O5/c1-13-2-3-14-15(12-13)20-11-9-18-7-5-16-4-6-17-8-10-19-14/h2-3,12H,4-11H2,1H3 |
InChiKey: | InChIKey=HCQGDZNYDMLVRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.