* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AMINO-4-SEC-BUTYL-PHENOL |
CAS: | 3280-71-5 |
English Synonyms: | 2-AMINO-4-(BUTAN-2-YL)PHENOL ; 2-AMINO-4-SEC-BUTYL-PHENOL |
MDL Number.: | MFCD00025184 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCC(C)c1ccc(c(c1)N)O |
InChi: | InChI=1S/C10H15NO/c1-3-7(2)8-4-5-10(12)9(11)6-8/h4-7,12H,3,11H2,1-2H3 |
InChiKey: | InChIKey=XKJRYOAGNVYYIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.