* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RIMITEROL |
CAS: | 32953-89-2 |
English Synonyms: | RIMITEROL |
MDL Number.: | MFCD00869405 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | c1cc(c(cc1[C@H]([C@@H]2CCCCN2)O)O)O |
InChi: | InChI=1S/C12H17NO3/c14-10-5-4-8(7-11(10)15)12(16)9-3-1-2-6-13-9/h4-5,7,9,12-16H,1-3,6H2/t9-,12+/m0/s1 |
InChiKey: | InChIKey=IYMMESGOJVNCKV-JOYOIKCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.