* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,6,7-TRIMETHYL-1H-INDAZOLE |
| CAS: | 33101-40-5 |
| English Synonyms: | 3,6,7-TRIMETHYL-1H-INDAZOLE ; INDAZOLE, 3,6,7-TRIMETHYL- |
| MDL Number.: | MFCD17010098 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(n[nH]c2c1C)C |
| InChi: | InChI=1S/C10H12N2/c1-6-4-5-9-8(3)11-12-10(9)7(6)2/h4-5H,1-3H3,(H,11,12) |
| InChiKey: | InChIKey=ZQLSOQQKKXHBNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.