* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-((4-CL-PHENOXY)ME)-1-ME-6,7-DIHYDRO(1,3)OXAZOLO(2,3-F)PURINE-2,4(1H,3H)-DIONE |
CAS: | 332384-51-7 |
English Synonyms: | 7-((4-CL-PHENOXY)ME)-1-ME-6,7-DIHYDRO(1,3)OXAZOLO(2,3-F)PURINE-2,4(1H,3H)-DIONE |
MDL Number.: | MFCD02049359 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | Cn1c2c(c(=O)[nH]c1=O)n3c(n2)OC(C3)COc4ccc(cc4)Cl |
InChi: | InChI=1S/C15H13ClN4O4/c1-19-12-11(13(21)18-14(19)22)20-6-10(24-15(20)17-12)7-23-9-4-2-8(16)3-5-9/h2-5,10H,6-7H2,1H3,(H,18,21,22) |
InChiKey: | InChIKey=YUKBQZBKWAMWGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.