Molecular Structure:
CAS No.:
3343-46-2
Product Name.:
CCD No.:CCD00089721
Formula:C6 H13 N O2
MolWeight:133.163
![ISOLEUCINE, L-[1-14C] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | ISOLEUCINE, L-[1-14C] |
| CAS： | 3343-46-2 |
| English Synonyms： | ISOLEUCINE, L-[1-14C] ; L-ISOLEUCINE, [14C(U)]- |
| MDL Number.： | MFCD00189837 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CC[C@H](C)[C@@H]([14C](=O)O)N |
| InChi： | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i6+2 |
| InChiKey： | InChIKey=AGPKZVBTJJNPAG-AABRNSQYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
