* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOLEUCINE, L-[1-14C] |
CAS: | 3343-46-2 |
English Synonyms: | L-ISOLEUCINE, [14C(U)]- ; ISOLEUCINE, L-[1-14C] |
MDL Number.: | MFCD00189837 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC[C@H](C)[C@@H]([14C](=O)O)N |
InChi: | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i6+2 |
InChiKey: | InChIKey=AGPKZVBTJJNPAG-AABRNSQYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.