* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AA-13C6 |
| CAS: | 335081-06-6 |
| English Synonyms: | 2-AA-13C6 ; ANTHRANILIC ACID-(RING-13C6) ; 2-AMINOBENZOIC ACID-13C6 |
| MDL Number.: | MFCD01317338 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [13cH]1[13cH][13cH][13c]([13c]([13cH]1)C(=O)O)N |
| InChi: | InChI=1S/C7H7NO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H,9,10)/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChiKey: | InChIKey=RWZYAGGXGHYGMB-IDEBNGHGSA-N |
|
|
| Melting Point: | 144-148 DEG C |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+6 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 143.04 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.