* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,4-DI-TERT-PENTYLBENZENE |
CAS: | 3373-10-2 |
English Synonyms: | 1,4-DI-TERT-PENTYLBENZENE |
MDL Number.: | MFCD00060940 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCC(C)(C)c1ccc(cc1)C(C)(C)CC |
InChi: | InChI=1S/C16H26/c1-7-15(3,4)13-9-11-14(12-10-13)16(5,6)8-2/h9-12H,7-8H2,1-6H3 |
InChiKey: | InChIKey=KNLFZJBLNQRLEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.