* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Ethanol, 2-[(2-methoxyphenyl)methoxy]- |
CAS: | 33756-81-9 |
English Synonyms: | ETHANOL, 2-[(2-METHOXYPHENYL)METHOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC1=C(C=CC=C1)COCCO |
InChi: | InChI=1S/C10H14O3/c1-12-10-5-3-2-4-9(10)8-13-7-6-11/h2-5,11H,6-8H2,1H3 |
InChiKey: | InChIKey=TUACQCVHBZGPSE-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.