* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-[2-(1H-1,2,4-TRIAZOL-1-YL)ETHANIMIDOYL]UREA |
CAS: | 338418-51-2 |
English Synonyms: | N-[2-(1H-1,2,4-TRIAZOL-1-YL)ETHANIMIDOYL]UREA ; [2-(1H-1,2,4-TRIAZOL-1-YL)ETHANIMIDOYL]UREA |
MDL Number.: | MFCD00172039 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ncn(n1)CC(=N)NC(=O)N |
InChi: | InChI=1S/C5H8N6O/c6-4(10-5(7)12)1-11-3-8-2-9-11/h2-3H,1H2,(H4,6,7,10,12) |
InChiKey: | InChIKey=IFHHSMWQYHRBFE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.